ChemNet > CAS > 374538-04-2 4-Cyclohexylbenzeneboronic acid
374538-04-2 4-Cyclohexylbenzeneboronic acid
| Nome del prodotto |
4-Cyclohexylbenzeneboronic acid |
| Sinonimi |
4-Cyclohexylphenylboronic acid |
| Formula molecolare |
C12H17BO2 |
| Peso Molecolare |
204.0732 |
| InChI |
InChI=1/C12H17BO2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10,14-15H,1-5H2 |
| Numero CAS |
374538-04-2 |
| Struttura molecolare |
|
| Densità |
1.09g/cm3 |
| Punto di ebollizione |
363.7°C at 760 mmHg |
| Indice di rifrazione |
1.543 |
| Punto d'infiammabilità |
173.8°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
